C31H29ClN4O5 — CID 5000452
N-butyl-4-chloro-N-[2-[4-(4-methoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 5000452) has the molecular formula C31H29ClN4O5 and a molecular weight of 573.05 g/mol. Its IUPAC name is N-butyl-4-chloro-N-[2-[4-(4-methoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-butyl-4-chloro-N-[2-[4-(4-methoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5000452 |
| Molecular Formula | C31H29ClN4O5 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | N-butyl-4-chloro-N-[2-[4-(4-methoxyphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N1c2ccccc2-n2cccc2C1c1ccc(OC)cc1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H29ClN4O5/c1-3-4-17-33(31(38)22-13-16-24(32)28(19-22)36(39)40)20-29(37)35-26-9-6-5-8-25(26)34-18-7-10-27(34)30(35)21-11-14-23(41-2)15-12-21/h5-16,18-19,30H,3-4,17,20H2,1-2H3 |
| InChIKey | SGNLMDIGAKDBEE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|