C29H23ClN4O4 — CID 42753568
4-chloro-N-cyclopropyl-3-nitro-N-[2-oxo-2-(4-phenyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)ethyl]benzamide (PubChem CID 42753568) has the molecular formula C29H23ClN4O4 and a molecular weight of 526.98 g/mol. Its IUPAC name is 4-chloro-N-cyclopropyl-3-nitro-N-[2-oxo-2-(4-phenyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-cyclopropyl-3-nitro-N-[2-oxo-2-(4-phenyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 42753568 |
| Molecular Formula | C29H23ClN4O4 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 4-chloro-N-cyclopropyl-3-nitro-N-[2-oxo-2-(4-phenyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)ethyl]benzamide |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N(CC(=O)N1c2ccccc2-n2cccc2C1c1ccccc1)C1CC1 |
| InChI | InChI=1S/C29H23ClN4O4/c30-22-15-12-20(17-26(22)34(37)38)29(36)32(21-13-14-21)18-27(35)33-24-10-5-4-9-23(24)31-16-6-11-25(31)28(33)19-7-2-1-3-8-19/h1-12,15-17,21,28H,13-14,18H2 |
| InChIKey | PAYROVCCRVHOFM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|