C29H25ClN4O4 — CID 3479903
N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 3479903) has the molecular formula C29H25ClN4O4 and a molecular weight of 529.00 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3479903 |
| Molecular Formula | C29H25ClN4O4 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CC(=O)N1c2ccccc2-n2cccc2C1c1cccc(Cl)c1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H25ClN4O4/c1-19(2)32(29(36)21-9-6-11-23(17-21)34(37)38)18-27(35)33-25-13-4-3-12-24(25)31-15-7-14-26(31)28(33)20-8-5-10-22(30)16-20/h3-17,19,28H,18H2,1-2H3 |
| InChIKey | XXQGFJAIQQHYCW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|