C26H27Cl2N3O2 — CID 42660318
N-butyl-2-chloro-N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide (PubChem CID 42660318) has the molecular formula C26H27Cl2N3O2 and a molecular weight of 484.43 g/mol. Its IUPAC name is N-butyl-2-chloro-N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide.
| Compound Name | N-butyl-2-chloro-N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 42660318 |
| Molecular Formula | C26H27Cl2N3O2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-butyl-2-chloro-N-[2-[4-(3-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide |
| SMILES | CCCCN(CC(=O)N1c2ccccc2-n2cccc2C1c1cccc(Cl)c1)C(=O)C(C)Cl |
| InChI | InChI=1S/C26H27Cl2N3O2/c1-3-4-14-29(26(33)18(2)27)17-24(32)31-22-12-6-5-11-21(22)30-15-8-13-23(30)25(31)19-9-7-10-20(28)16-19/h5-13,15-16,18,25H,3-4,14,17H2,1-2H3 |
| InChIKey | LPIPGXXKZQCQHM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|