C29H36N4O2 — CID 3274495
1,3-dibutyl-1-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea (PubChem CID 3274495) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1,3-dibutyl-1-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea.
| Compound Name | 1,3-dibutyl-1-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 3274495 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1,3-dibutyl-1-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea |
| SMILES | CCCCNC(=O)N(CCCC)CC(=O)N1c2ccccc2-n2cccc2C1c1cccc(C)c1 |
| InChI | InChI=1S/C29H36N4O2/c1-4-6-17-30-29(35)31(18-7-5-2)21-27(34)33-25-15-9-8-14-24(25)32-19-11-16-26(32)28(33)23-13-10-12-22(3)20-23/h8-16,19-20,28H,4-7,17-18,21H2,1-3H3,(H,30,35) |
| InChIKey | LLUFBRHJMABABS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|