C27H30ClN3O2 — CID 4028201
N-butyl-2-chloro-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide (PubChem CID 4028201) has the molecular formula C27H30ClN3O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is N-butyl-2-chloro-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide.
| Compound Name | N-butyl-2-chloro-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 4028201 |
| Molecular Formula | C27H30ClN3O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-butyl-2-chloro-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]propanamide |
| SMILES | CCCCN(CC(=O)N1c2ccccc2-n2cccc2C1c1cccc(C)c1)C(=O)C(C)Cl |
| InChI | InChI=1S/C27H30ClN3O2/c1-4-5-15-29(27(33)20(3)28)18-25(32)31-23-13-7-6-12-22(23)30-16-9-14-24(30)26(31)21-11-8-10-19(2)17-21/h6-14,16-17,20,26H,4-5,15,18H2,1-3H3 |
| InChIKey | ZJADSDTZXDVOSE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|