C28H33ClN4O2 — CID 42752467
1,3-dibutyl-1-[2-[4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea (PubChem CID 42752467) has the molecular formula C28H33ClN4O2 and a molecular weight of 493.05 g/mol. Its IUPAC name is 1,3-dibutyl-1-[2-[4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea.
| Compound Name | 1,3-dibutyl-1-[2-[4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 42752467 |
| Molecular Formula | C28H33ClN4O2 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1,3-dibutyl-1-[2-[4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]urea |
| SMILES | CCCCNC(=O)N(CCCC)CC(=O)N1c2ccccc2-n2cccc2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H33ClN4O2/c1-3-5-17-30-28(35)31(18-6-4-2)20-26(34)33-24-11-8-7-10-23(24)32-19-9-12-25(32)27(33)21-13-15-22(29)16-14-21/h7-16,19,27H,3-6,17-18,20H2,1-2H3,(H,30,35) |
| InChIKey | OZRJRUKHPLMBJN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|