C30H25ClN4O4 — CID 5097941
2-chloro-N-cyclopropyl-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 5097941) has the molecular formula C30H25ClN4O4 and a molecular weight of 541.01 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5097941 |
| Molecular Formula | C30H25ClN4O4 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-[2-[4-(3-methylphenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | Cc1cccc(C2c3cccn3-c3ccccc3N2C(=O)CN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)C2CC2)c1 |
| InChI | InChI=1S/C30H25ClN4O4/c1-19-6-4-7-20(16-19)29-27-10-5-15-32(27)25-8-2-3-9-26(25)34(29)28(36)18-33(21-11-12-21)30(37)23-14-13-22(35(38)39)17-24(23)31/h2-10,13-17,21,29H,11-12,18H2,1H3 |
| InChIKey | GMTHAZJWLMIGOS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|