C19H23NO3 — CID 39453886
2-[(3-ethoxyphenyl)methyl-(2-phenylethyl)amino]acetic acid (PubChem CID 39453886) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[(3-ethoxyphenyl)methyl-(2-phenylethyl)amino]acetic acid.
| Compound Name | 2-[(3-ethoxyphenyl)methyl-(2-phenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 39453886 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[(3-ethoxyphenyl)methyl-(2-phenylethyl)amino]acetic acid |
| SMILES | CCOc1cccc(CN(CCc2ccccc2)CC(=O)O)c1 |
| InChI | InChI=1S/C19H23NO3/c1-2-23-18-10-6-9-17(13-18)14-20(15-19(21)22)12-11-16-7-4-3-5-8-16/h3-10,13H,2,11-12,14-15H2,1H3,(H,21,22) |
| InChIKey | IUAMPFNGMYPGKZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |