C16H16F3N3O2 — CID 3946285
1-methyl-6-propyl-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 3946285) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-methyl-6-propyl-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 1-methyl-6-propyl-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 3946285 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-methyl-6-propyl-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | CCCN1CC2=C(C1=O)C(c1cc(F)c(F)cc1F)NC(=O)N2C |
| InChI | InChI=1S/C16H16F3N3O2/c1-3-4-22-7-12-13(15(22)23)14(20-16(24)21(12)2)8-5-10(18)11(19)6-9(8)17/h5-6,14H,3-4,7H2,1-2H3,(H,20,24) |
| InChIKey | GPEYBISMRIWIII-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|