C20H17F3N4O2 — CID 42789177
1-methyl-6-(2-pyridin-2-ylethyl)-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 42789177) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is 1-methyl-6-(2-pyridin-2-ylethyl)-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 1-methyl-6-(2-pyridin-2-ylethyl)-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 42789177 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-methyl-6-(2-pyridin-2-ylethyl)-4-(2,4,5-trifluorophenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | CN1C(=O)NC(c2cc(F)c(F)cc2F)C2=C1CN(CCc1ccccn1)C2=O |
| InChI | InChI=1S/C20H17F3N4O2/c1-26-16-10-27(7-5-11-4-2-3-6-24-11)19(28)17(16)18(25-20(26)29)12-8-14(22)15(23)9-13(12)21/h2-4,6,8-9,18H,5,7,10H2,1H3,(H,25,29) |
| InChIKey | NMRKINKWZUGXQL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|