C17H20F3N3O2S — CID 39465986
N-cyclopropyl-2-[4-[2-(trifluoromethylsulfanyl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 39465986) has the molecular formula C17H20F3N3O2S and a molecular weight of 387.43 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-(trifluoromethylsulfanyl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-(trifluoromethylsulfanyl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 39465986 |
| Molecular Formula | C17H20F3N3O2S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-(trifluoromethylsulfanyl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2SC(F)(F)F)CC1)NC1CC1 |
| InChI | InChI=1S/C17H20F3N3O2S/c18-17(19,20)26-14-4-2-1-3-13(14)16(25)23-9-7-22(8-10-23)11-15(24)21-12-5-6-12/h1-4,12H,5-11H2,(H,21,24) |
| InChIKey | HZRDZQJKPBYRRX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |