C23H21N3O2 — CID 39476448
(2R)-N'-benzyl-2-(4-cyanophenoxy)-N'-phenylpropanehydrazide (PubChem CID 39476448) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2R)-N'-benzyl-2-(4-cyanophenoxy)-N'-phenylpropanehydrazide.
| Compound Name | (2R)-N'-benzyl-2-(4-cyanophenoxy)-N'-phenylpropanehydrazide |
|---|---|
| PubChem CID | 39476448 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R)-N'-benzyl-2-(4-cyanophenoxy)-N'-phenylpropanehydrazide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O2/c1-18(28-22-14-12-19(16-24)13-15-22)23(27)25-26(21-10-6-3-7-11-21)17-20-8-4-2-5-9-20/h2-15,18H,17H2,1H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | XNDBGFNWXBWPCM-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|