C24H28N2O4 — CID 8856714
[(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 8856714) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 8856714 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)O[C@H](C)C(=O)N(Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H28N2O4/c1-17(22(27)26(24(3,4)5)16-20-9-7-6-8-10-20)30-23(28)18(2)29-21-13-11-19(15-25)12-14-21/h6-14,17-18H,16H2,1-5H3/t17-,18-/m1/s1 |
| InChIKey | CKAAQRGOVUJUMZ-QZTJIDSGSA-N |
| XLogP | 4.08 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |