C22H26FNO4 — CID 8976367
[(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate (PubChem CID 8976367) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8976367 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [(2R)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H](C)C(=O)N(Cc2ccccc2)C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C22H26FNO4/c1-15(28-21(26)18-12-11-17(27-5)13-19(18)23)20(25)24(22(2,3)4)14-16-9-7-6-8-10-16/h6-13,15H,14H2,1-5H3/t15-/m1/s1 |
| InChIKey | ZQILPCVJKQJFNK-OAHLLOKOSA-N |
| XLogP | 4.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |