C25H20N2O4 — CID 39500037
N-[3-[(3-cyanophenyl)methoxy]phenyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 39500037) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 39500037 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cccc(OCc3cccc(C#N)c3)c2)oc2ccccc12 |
| InChI | InChI=1S/C25H20N2O4/c1-29-16-22-21-10-2-3-11-23(21)31-24(22)25(28)27-19-8-5-9-20(13-19)30-15-18-7-4-6-17(12-18)14-26/h2-13H,15-16H2,1H3,(H,27,28) |
| InChIKey | PNESAAXYYBZYGK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |