C14H7Br4N3O4 — CID 3952205
3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoic acid (PubChem CID 3952205) has the molecular formula C14H7Br4N3O4 and a molecular weight of 600.84 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 3952205 |
| Molecular Formula | C14H7Br4N3O4 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 596.72 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1cnc[nH]1)N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C14H7Br4N3O4/c15-8-6-7(9(16)11(18)10(8)17)13(23)21(12(6)22)5(14(24)25)1-4-2-19-3-20-4/h2-3,5H,1H2,(H,19,20)(H,24,25) |
| InChIKey | ZEHYBFIGHOHRPX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|