C14H6Br4N3O4- — CID 4182735
3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 4182735) has the molecular formula C14H6Br4N3O4- and a molecular weight of 599.84 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 4182735 |
| Molecular Formula | C14H6Br4N3O4- |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 595.71 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C([O-])C(Cc1cnc[nH]1)N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C14H7Br4N3O4/c15-8-6-7(9(16)11(18)10(8)17)13(23)21(12(6)22)5(14(24)25)1-4-2-19-3-20-4/h2-3,5H,1H2,(H,19,20)(H,24,25)/p-1 |
| InChIKey | ZEHYBFIGHOHRPX-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|