C17H24N2O3 — CID 3952743
tert-butyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 3952743) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 3952743 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-12-7-9-13(10-8-12)18-15(20)14-6-5-11-19(14)16(21)22-17(2,3)4/h7-10,14H,5-6,11H2,1-4H3,(H,18,20) |
| InChIKey | RKYIEPATGAUQPC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |