C48H61N5O5 — CID 3954449
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 3954449) has the molecular formula C48H61N5O5 and a molecular weight of 788.05 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3954449 |
| Molecular Formula | C48H61N5O5 |
| Molecular Weight | 788.05 g/mol |
| Exact Mass | 787.47 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CN4CCCC4CN4CCCC4)CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C48H61N5O5/c49-43-14-5-6-15-44(43)51-47(56)17-4-2-1-3-16-46(55)50-31-36-11-9-12-40(29-36)37-22-24-39(25-23-37)48-57-42(30-45(58-48)38-20-18-35(34-54)19-21-38)33-53-28-10-13-41(53)32-52-26-7-8-27-52/h5-6,9,11-12,14-15,18-25,29,41-42,45,48,54H,1-4,7-8,10,13,16-17,26-28,30-34,49H2,(H,50,55)(H,51,56) |
| InChIKey | BVQLULZDISWYGI-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.05 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|