C18H17NO3S — CID 3956809
2-(4-butoxyphenyl)-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 3956809) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3956809 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CCCCOc1ccc(C2=NC(=Cc3cccs3)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-2-3-10-21-14-8-6-13(7-9-14)17-19-16(18(20)22-17)12-15-5-4-11-23-15/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | RYFZMKJYMLEHAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|