C18H16BrN3O — CID 39584379
3-(4-bromophenyl)-N-ethyl-N-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 39584379) has the molecular formula C18H16BrN3O and a molecular weight of 370.25 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-ethyl-N-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-ethyl-N-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39584379 |
| Molecular Formula | C18H16BrN3O |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3-(4-bromophenyl)-N-ethyl-N-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CCN(C(=O)c1cc(-c2ccc(Br)cc2)n[nH]1)c1ccccc1 |
| InChI | InChI=1S/C18H16BrN3O/c1-2-22(15-6-4-3-5-7-15)18(23)17-12-16(20-21-17)13-8-10-14(19)11-9-13/h3-12H,2H2,1H3,(H,20,21) |
| InChIKey | HJUOKCODAOOHFR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |