C25H21N5O3S — CID 39592143
N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide (PubChem CID 39592143) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 39592143 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)c1ccc(SCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H21N5O3S/c31-23-13-26-25(33)30(23)14-17-4-3-5-19(12-17)28-24(32)18-7-9-21(10-8-18)34-16-20-15-29-11-2-1-6-22(29)27-20/h1-12,15H,13-14,16H2,(H,26,33)(H,28,32) |
| InChIKey | MMZGCGFZOAKELY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|