C19H26N4 — CID 3960673
3-(1-benzylpiperidin-2-yl)-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine (PubChem CID 3960673) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-2-yl)-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine.
| Compound Name | 3-(1-benzylpiperidin-2-yl)-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 3960673 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 3-(1-benzylpiperidin-2-yl)-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
| SMILES | c1ccc(CN2CCCCC2c2[nH]nc3c2CCCCN3)cc1 |
| InChI | InChI=1S/C19H26N4/c1-2-8-15(9-3-1)14-23-13-7-5-11-17(23)18-16-10-4-6-12-20-19(16)22-21-18/h1-3,8-9,17H,4-7,10-14H2,(H2,20,21,22) |
| InChIKey | JXYOHKMBZJSCOP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |