C16H21N5OS2 — CID 39612986
N-[(R)-cyclopentyl(thiophen-2-yl)methyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide (PubChem CID 39612986) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[(R)-cyclopentyl(thiophen-2-yl)methyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(R)-cyclopentyl(thiophen-2-yl)methyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 39612986 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(R)-cyclopentyl(thiophen-2-yl)methyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)N[C@@H](c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C16H21N5OS2/c22-14(10-24-16-18-19-20-21(16)12-7-8-12)17-15(11-4-1-2-5-11)13-6-3-9-23-13/h3,6,9,11-12,15H,1-2,4-5,7-8,10H2,(H,17,22)/t15-/m1/s1 |
| InChIKey | IZJNKBLYBLBQEL-OAHLLOKOSA-N |
| XLogP | 3.21 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |