C18H22N4O3 — CID 39616511
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 39616511) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 39616511 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H22N4O3/c23-16-7-11-22(18(25)20-16)13-17(24)19-8-3-9-21-10-6-14-4-1-2-5-15(14)12-21/h1-2,4-5,7,11H,3,6,8-10,12-13H2,(H,19,24)(H,20,23,25) |
| InChIKey | GRGVMDIRBNEENL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|