C17H20N2OS2 — CID 39629590
1-cyano-N-[3-(1,3-dithian-2-yl)phenyl]cyclopentane-1-carboxamide (PubChem CID 39629590) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-cyano-N-[3-(1,3-dithian-2-yl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-cyano-N-[3-(1,3-dithian-2-yl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 39629590 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-cyano-N-[3-(1,3-dithian-2-yl)phenyl]cyclopentane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2cccc(C3SCCCS3)c2)CCCC1 |
| InChI | InChI=1S/C17H20N2OS2/c18-12-17(7-1-2-8-17)16(20)19-14-6-3-5-13(11-14)15-21-9-4-10-22-15/h3,5-6,11,15H,1-2,4,7-10H2,(H,19,20) |
| InChIKey | YPFGSFOISNZPCD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |