C21H17BrClNO3S — CID 3963233
N-[4-bromo-2-(4-chlorobenzoyl)phenyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 3963233) has the molecular formula C21H17BrClNO3S and a molecular weight of 478.80 g/mol. Its IUPAC name is N-[4-bromo-2-(4-chlorobenzoyl)phenyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-bromo-2-(4-chlorobenzoyl)phenyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3963233 |
| Molecular Formula | C21H17BrClNO3S |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | N-[4-bromo-2-(4-chlorobenzoyl)phenyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(Br)cc2C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H17BrClNO3S/c1-14-3-10-18(11-4-14)28(26,27)24(2)20-12-7-16(22)13-19(20)21(25)15-5-8-17(23)9-6-15/h3-13H,1-2H3 |
| InChIKey | AZMXRIQBJJZRAC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |