C28H28N4NiO2 — CID 3963470
bis(2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel (PubChem CID 3963470) has the molecular formula C28H28N4NiO2 and a molecular weight of 511.25 g/mol. Its IUPAC name is bis(2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel.
| Compound Name | bis(2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel |
|---|---|
| PubChem CID | 3963470 |
| Molecular Formula | C28H28N4NiO2 |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | bis(2-[(6-methyl-2-pyridinyl)methyliminomethyl]phenol);nickel |
| SMILES | Cc1cccc(C/N=C/c2ccccc2O)n1.Cc1cccc(CN=Cc2ccccc2O)n1.[Ni] |
| InChI | InChI=1S/2C14H14N2O.Ni/c2*1-11-5-4-7-13(16-11)10-15-9-12-6-2-3-8-14(12)17;/h2*2-9,17H,10H2,1H3;/b15-9+;; |
| InChIKey | DIEJJXFZQMWWFM-CBNWXSEKSA-N |
| XLogP | 5.43 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|