C22H22ClFN4OS — CID 3963493
2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-2-phenylethanone (PubChem CID 3963493) has the molecular formula C22H22ClFN4OS and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-2-phenylethanone.
| Compound Name | 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 3963493 |
| Molecular Formula | C22H22ClFN4OS |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-2-phenylethanone |
| SMILES | O=C(C(Cl)c1ccccc1)N1CCCN(c2nc(Cc3ccc(F)cc3)ns2)CC1 |
| InChI | InChI=1S/C22H22ClFN4OS/c23-20(17-5-2-1-3-6-17)21(29)27-11-4-12-28(14-13-27)22-25-19(26-30-22)15-16-7-9-18(24)10-8-16/h1-3,5-10,20H,4,11-15H2 |
| InChIKey | PYWKIUXJYCBEIU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|