C21H20ClFN4OS — CID 4222761
2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]-2-phenylethanone (PubChem CID 4222761) has the molecular formula C21H20ClFN4OS and a molecular weight of 430.94 g/mol. Its IUPAC name is 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 4222761 |
| Molecular Formula | C21H20ClFN4OS |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-chloro-1-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]-2-phenylethanone |
| SMILES | O=C(C(Cl)c1ccccc1)N1CCN(c2nc(Cc3ccc(F)cc3)ns2)CC1 |
| InChI | InChI=1S/C21H20ClFN4OS/c22-19(16-4-2-1-3-5-16)20(28)26-10-12-27(13-11-26)21-24-18(25-29-21)14-15-6-8-17(23)9-7-15/h1-9,19H,10-14H2 |
| InChIKey | YSGCSDKRXFNPBJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|