About 4-(2,4-dinitrophenoxy)aniline
4-(2,4-dinitrophenoxy)aniline (PubChem CID 3965305) has the molecular formula C12H9N3O5
and a molecular weight of 275.22 g/mol. Its IUPAC name is 4-(2,4-dinitrophenoxy)aniline.
Molecular Properties
| Compound Name | 4-(2,4-dinitrophenoxy)aniline |
| PubChem CID | 3965305 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-(2,4-dinitrophenoxy)aniline |
| SMILES | Nc1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9N3O5/c13-8-1-4-10(5-2-8)20-12-6-3-9(14(16)17)7-11(12)15(18)19/h1-7H,13H2 |
| InChIKey | LFVYDUHHPGRLAT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dinitrophenoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dinitrophenoxy)aniline?
The IUPAC name of 4-(2,4-dinitrophenoxy)aniline (CID 3965305) is 4-(2,4-dinitrophenoxy)aniline.
What is the SMILES notation for 4-(2,4-dinitrophenoxy)aniline?
The canonical SMILES for 4-(2,4-dinitrophenoxy)aniline is Nc1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of 4-(2,4-dinitrophenoxy)aniline?
The InChIKey is LFVYDUHHPGRLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O5/c13-8-1-4-10(5-2-8)20-12-6-3-9(14(16)17)7-11(12)15(18)19/h1-7H,13H2.
What are the key properties of 4-(2,4-dinitrophenoxy)aniline?
4-(2,4-dinitrophenoxy)aniline has a molecular weight of 275.22 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dinitrophenoxy)aniline is sourced from PubChem (CID 3965305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).