C25H26N4O3 — CID 3968568
3,3-dimethyl-5-oxo-N,N-diphenyl-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide (PubChem CID 3968568) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-N,N-diphenyl-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide.
| Compound Name | 3,3-dimethyl-5-oxo-N,N-diphenyl-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide |
|---|---|
| PubChem CID | 3968568 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3,3-dimethyl-5-oxo-N,N-diphenyl-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide |
| SMILES | CC(C)(CC(=O)NNC(=O)c1cccnc1)CC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N4O3/c1-25(2,16-22(30)27-28-24(32)19-10-9-15-26-18-19)17-23(31)29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-15,18H,16-17H2,1-2H3,(H,27,30)(H,28,32) |
| InChIKey | OPQJWOIXMNENSS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|