C19H20Cl2N4O3 — CID 4236223
N-(2,3-dichlorophenyl)-3,3-dimethyl-5-oxo-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide (PubChem CID 4236223) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3,3-dimethyl-5-oxo-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide.
| Compound Name | N-(2,3-dichlorophenyl)-3,3-dimethyl-5-oxo-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide |
|---|---|
| PubChem CID | 4236223 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3,3-dimethyl-5-oxo-5-[2-(pyridine-3-carbonyl)hydrazinyl]pentanamide |
| SMILES | CC(C)(CC(=O)NNC(=O)c1cccnc1)CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-19(2,9-15(26)23-14-7-3-6-13(20)17(14)21)10-16(27)24-25-18(28)12-5-4-8-22-11-12/h3-8,11H,9-10H2,1-2H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | TVPRQKHCUODEAN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|