C18H11BrN4O4 — CID 39704610
N'-(7-bromo-1-benzofuran-2-carbonyl)-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 39704610) has the molecular formula C18H11BrN4O4 and a molecular weight of 427.21 g/mol. Its IUPAC name is N'-(7-bromo-1-benzofuran-2-carbonyl)-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-(7-bromo-1-benzofuran-2-carbonyl)-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 39704610 |
| Molecular Formula | C18H11BrN4O4 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N'-(7-bromo-1-benzofuran-2-carbonyl)-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)c1n[nH]c(=O)c2ccccc12)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C18H11BrN4O4/c19-12-7-3-4-9-8-13(27-15(9)12)17(25)22-23-18(26)14-10-5-1-2-6-11(10)16(24)21-20-14/h1-8H,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | YEZDWSXNPTXVOM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|