C22H34N2O4S — CID 39711649
N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(3-phenylpropylsulfonyl)acetamide (PubChem CID 39711649) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(3-phenylpropylsulfonyl)acetamide.
| Compound Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(3-phenylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 39711649 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-(3-phenylpropylsulfonyl)acetamide |
| SMILES | O=C(CS(=O)(=O)CCCc1ccccc1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H34N2O4S/c25-21(18-29(26,27)17-7-10-20-8-3-1-4-9-20)23-19-22(11-5-2-6-12-22)24-13-15-28-16-14-24/h1,3-4,8-9H,2,5-7,10-19H2,(H,23,25) |
| InChIKey | XHSLARORHNGABI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |