C14H18N4O4 — CID 3971401
N'-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)acetyl]pyridine-3-carbohydrazide (PubChem CID 3971401) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is N'-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 3971401 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N'-[2-(2-oxo-2-pyrrolidin-1-ylethoxy)acetyl]pyridine-3-carbohydrazide |
| SMILES | O=C(COCC(=O)N1CCCC1)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C14H18N4O4/c19-12(9-22-10-13(20)18-6-1-2-7-18)16-17-14(21)11-4-3-5-15-8-11/h3-5,8H,1-2,6-7,9-10H2,(H,16,19)(H,17,21) |
| InChIKey | CSRWXQCWWWOUQE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|