C24H26FN5O4S — CID 39717054
N,N-diethyl-3-[[[1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 39717054) has the molecular formula C24H26FN5O4S and a molecular weight of 499.57 g/mol. Its IUPAC name is N,N-diethyl-3-[[[1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[[[1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39717054 |
| Molecular Formula | C24H26FN5O4S |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N,N-diethyl-3-[[[1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2nn(-c3ccccc3F)c3c2CCC3)c1 |
| InChI | InChI=1S/C24H26FN5O4S/c1-3-29(4-2)35(33,34)17-10-7-9-16(15-17)23(31)26-27-24(32)22-18-11-8-14-20(18)30(28-22)21-13-6-5-12-19(21)25/h5-7,9-10,12-13,15H,3-4,8,11,14H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | ZYCASAITBMKGHM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|