C21H18ClN3O4 — CID 3971972
[1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)-2-cyanoprop-2-enoate (PubChem CID 3971972) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)-2-cyanoprop-2-enoate.
| Compound Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 3971972 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)OC(=O)C(C#N)=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O4/c1-13(20(27)25-19-9-7-18(8-10-19)24-14(2)26)29-21(28)16(12-23)11-15-3-5-17(22)6-4-15/h3-11,13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | PUWMKWRPTFBHCL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|