C20H16Cl2N2O3 — CID 7581416
[(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate (PubChem CID 7581416) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7581416 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)O[C@H](C)C(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-12-3-5-14(6-4-12)9-15(11-23)20(26)27-13(2)19(25)24-18-10-16(21)7-8-17(18)22/h3-10,13H,1-2H3,(H,24,25)/b15-9+/t13-/m1/s1 |
| InChIKey | GUOKELLDVBTVLH-GULXKOIASA-N |
| XLogP | 4.78 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|