C21H17F3N2O3 — CID 7582038
[(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate (PubChem CID 7582038) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7582038 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)O[C@@H](C)C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H17F3N2O3/c1-13-6-8-15(9-7-13)10-16(12-25)20(28)29-14(2)19(27)26-18-5-3-4-17(11-18)21(22,23)24/h3-11,14H,1-2H3,(H,26,27)/b16-10+/t14-/m0/s1 |
| InChIKey | FQRMXIFPFUAQOU-KNGSKEOJSA-N |
| XLogP | 4.49 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|