C21H18F2N2O4 — CID 8740195
[(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 8740195) has the molecular formula C21H18F2N2O4 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8740195 |
| Molecular Formula | C21H18F2N2O4 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)O[C@H](C)C(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C21H18F2N2O4/c1-3-28-17-7-4-14(5-8-17)10-15(12-24)21(27)29-13(2)20(26)25-19-11-16(22)6-9-18(19)23/h4-11,13H,3H2,1-2H3,(H,25,26)/b15-10+/t13-/m1/s1 |
| InChIKey | HAJRHTKCFSRZPK-QQFZQELXSA-N |
| XLogP | 3.84 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|