C21H28N2O3S2 — CID 39736069
N-[(3aS,6aS)-3-[(4-methylphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide (PubChem CID 39736069) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-[(4-methylphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide.
| Compound Name | N-[(3aS,6aS)-3-[(4-methylphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 39736069 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[(3aS,6aS)-3-[(4-methylphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
| SMILES | Cc1ccc(CN2/C(=N/C(=O)CCC3CCCC3)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-15-6-8-17(9-7-15)12-23-18-13-28(25,26)14-19(18)27-21(23)22-20(24)11-10-16-4-2-3-5-16/h6-9,16,18-19H,2-5,10-14H2,1H3/b22-21-/t18-,19+/m0/s1 |
| InChIKey | XTQLHTOZELFIFF-DBWZVEGISA-N |
| XLogP | 3.56 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|