C21H27FN2O3S2 — CID 4975217
3-cyclopentyl-N-[3-[2-(4-fluorophenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide (PubChem CID 4975217) has the molecular formula C21H27FN2O3S2 and a molecular weight of 438.59 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-[2-(4-fluorophenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide.
| Compound Name | 3-cyclopentyl-N-[3-[2-(4-fluorophenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide |
|---|---|
| PubChem CID | 4975217 |
| Molecular Formula | C21H27FN2O3S2 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-cyclopentyl-N-[3-[2-(4-fluorophenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide |
| SMILES | O=C(CCC1CCCC1)/N=C1\SC2CS(=O)(=O)CC2N1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O3S2/c22-17-8-5-16(6-9-17)11-12-24-18-13-29(26,27)14-19(18)28-21(24)23-20(25)10-7-15-3-1-2-4-15/h5-6,8-9,15,18-19H,1-4,7,10-14H2/b23-21- |
| InChIKey | YSKYGXACGDRDLS-LNVKXUELSA-N |
| XLogP | 3.44 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|