C17H18ClF3N2S — CID 3973688
1-[[2-chloro-5-(trifluoromethyl)phenyl]-(5-methylthiophen-2-yl)methyl]piperazine (PubChem CID 3973688) has the molecular formula C17H18ClF3N2S and a molecular weight of 374.86 g/mol. Its IUPAC name is 1-[[2-chloro-5-(trifluoromethyl)phenyl]-(5-methylthiophen-2-yl)methyl]piperazine.
| Compound Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]-(5-methylthiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 3973688 |
| Molecular Formula | C17H18ClF3N2S |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]-(5-methylthiophen-2-yl)methyl]piperazine |
| SMILES | Cc1ccc(C(c2cc(C(F)(F)F)ccc2Cl)N2CCNCC2)s1 |
| InChI | InChI=1S/C17H18ClF3N2S/c1-11-2-5-15(24-11)16(23-8-6-22-7-9-23)13-10-12(17(19,20)21)3-4-14(13)18/h2-5,10,16,22H,6-9H2,1H3 |
| InChIKey | WHYJQDVSHYJBIY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |