C21H20Cl2N2O5S2 — CID 39740975
N-[(3aS,6aS)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 39740975) has the molecular formula C21H20Cl2N2O5S2 and a molecular weight of 515.44 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aS)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39740975 |
| Molecular Formula | C21H20Cl2N2O5S2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | N-[(3aS,6aS)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@@H]3N2c2cc(Cl)ccc2Cl)cc1OC |
| InChI | InChI=1S/C21H20Cl2N2O5S2/c1-29-17-6-3-12(7-18(17)30-2)8-20(26)24-21-25(15-9-13(22)4-5-14(15)23)16-10-32(27,28)11-19(16)31-21/h3-7,9,16,19H,8,10-11H2,1-2H3/b24-21-/t16-,19+/m0/s1 |
| InChIKey | VICTXJAODFUWFF-LXYRBDFESA-N |
| XLogP | 3.85 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|