C19H18ClN3O4S2 — CID 39742123
(3aR,6aR)-3-[(4-chlorophenyl)methyl]-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39742123) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is (3aR,6aR)-3-[(4-chlorophenyl)methyl]-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-3-[(4-chlorophenyl)methyl]-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39742123 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (3aR,6aR)-3-[(4-chlorophenyl)methyl]-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=[N+]([O-])c1ccc(CSC2=N[C@H]3CS(=O)(=O)C[C@@H]3N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClN3O4S2/c20-15-5-1-13(2-6-15)9-22-18-12-29(26,27)11-17(18)21-19(22)28-10-14-3-7-16(8-4-14)23(24)25/h1-8,17-18H,9-12H2/t17-,18-/m0/s1 |
| InChIKey | XRCIDIDUFSYNLX-ROUUACIJSA-N |
| XLogP | 3.52 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|