C20H21Cl2N3O3S — CID 39746370
ethyl (6S)-2-[[(E)-(2,4-dichlorophenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 39746370) has the molecular formula C20H21Cl2N3O3S and a molecular weight of 454.38 g/mol. Its IUPAC name is ethyl (6S)-2-[[(E)-(2,4-dichlorophenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6S)-2-[[(E)-(2,4-dichlorophenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 39746370 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | ethyl (6S)-2-[[(E)-(2,4-dichlorophenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)N/N=C/c2ccc(Cl)cc2Cl)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C20H21Cl2N3O3S/c1-3-28-19(26)17-14-7-4-11(2)8-16(14)29-18(17)24-20(27)25-23-10-12-5-6-13(21)9-15(12)22/h5-6,9-11H,3-4,7-8H2,1-2H3,(H2,24,25,27)/b23-10+/t11-/m0/s1 |
| InChIKey | FPNUHSXWNMMWSU-MOSLJXCSSA-N |
| XLogP | 5.51 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|