C28H31N3O5S — CID 19168435
ethyl 2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19168435) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is ethyl 2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19168435 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | ethyl 2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)N/N=C\c2ccc(OCc3ccccc3)c(OC)c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C28H31N3O5S/c1-4-35-27(32)25-21-12-10-18(2)14-24(21)37-26(25)30-28(33)31-29-16-20-11-13-22(23(15-20)34-3)36-17-19-8-6-5-7-9-19/h5-9,11,13,15-16,18H,4,10,12,14,17H2,1-3H3,(H2,30,31,33)/b29-16- |
| InChIKey | HTEDDOVWBBLQSA-MWLSYYOVSA-N |
| XLogP | 5.79 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|