C28H27N3O6S — CID 4079803
ethyl 2-[[2-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4079803) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4079803 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | ethyl 2-[[2-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3ccccc3)cc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C28H27N3O6S/c1-3-36-28(35)23-21-14-9-17(2)15-22(21)38-26(23)30-24(32)25(33)31-29-16-18-10-12-20(13-11-18)37-27(34)19-7-5-4-6-8-19/h4-8,10-13,16-17H,3,9,14-15H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | UDBMGFJSIWLUPC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|